C9H10N6O — CID 105023273
4-([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)pyrrolidin-2-one (PubChem CID 105023273) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)pyrrolidin-2-one.
| Compound Name | 4-([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 105023273 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)pyrrolidin-2-one |
| SMILES | O=C1CC(Nc2nccn3cnnc23)CN1 |
| InChI | InChI=1S/C9H10N6O/c16-7-3-6(4-11-7)13-8-9-14-12-5-15(9)2-1-10-8/h1-2,5-6H,3-4H2,(H,10,13)(H,11,16) |
| InChIKey | UXNYCLSBKKFHMB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |