C17H30O10Si — CID 10502344
(4R,5R,8R,9S)-9-hydroxy-8-(hydroxymethyl)-2,2-dimethyl-6-oxo-4-(2-trimethylsilylethoxymethoxymethyl)-1,3,7-trioxaspiro[4.4]nonane-9-carboxylic acid (PubChem CID 10502344) has the molecular formula C17H30O10Si and a molecular weight of 422.50 g/mol. Its IUPAC name is (4R,5R,8R,9S)-9-hydroxy-8-(hydroxymethyl)-2,2-dimethyl-6-oxo-4-(2-trimethylsilylethoxymethoxymethyl)-1,3,7-trioxaspiro[4.4]nonane-9-carboxylic acid.
| Compound Name | (4R,5R,8R,9S)-9-hydroxy-8-(hydroxymethyl)-2,2-dimethyl-6-oxo-4-(2-trimethylsilylethoxymethoxymethyl)-1,3,7-trioxaspiro[4.4]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 10502344 |
| Molecular Formula | C17H30O10Si |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (4R,5R,8R,9S)-9-hydroxy-8-(hydroxymethyl)-2,2-dimethyl-6-oxo-4-(2-trimethylsilylethoxymethoxymethyl)-1,3,7-trioxaspiro[4.4]nonane-9-carboxylic acid |
| SMILES | CC1(C)O[C@H](COCOCC[Si](C)(C)C)[C@]2(O1)C(=O)O[C@H](CO)[C@@]2(O)C(=O)O |
| InChI | InChI=1S/C17H30O10Si/c1-15(2)26-12(9-24-10-23-6-7-28(3,4)5)17(27-15)14(21)25-11(8-18)16(17,22)13(19)20/h11-12,18,22H,6-10H2,1-5H3,(H,19,20)/t11-,12-,16-,17+/m1/s1 |
| InChIKey | DFVGFJCIQSXXMW-SKNMWMDOSA-N |
| XLogP | -0.06 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|