C15H16IN3S — CID 105023630
N-ethyl-2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-iodophenyl)ethanamine (PubChem CID 105023630) has the molecular formula C15H16IN3S and a molecular weight of 397.29 g/mol. Its IUPAC name is N-ethyl-2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-iodophenyl)ethanamine.
| Compound Name | N-ethyl-2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 105023630 |
| Molecular Formula | C15H16IN3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-ethyl-2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-iodophenyl)ethanamine |
| SMILES | CCNC(Cc1cn2ccsc2n1)c1ccccc1I |
| InChI | InChI=1S/C15H16IN3S/c1-2-17-14(12-5-3-4-6-13(12)16)9-11-10-19-7-8-20-15(19)18-11/h3-8,10,14,17H,2,9H2,1H3 |
| InChIKey | SNMFRZPPUGLECH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|