C19H26N3+ — CID 10502377
6-(4,4-dimethylpiperazin-4-ium-1-yl)-7,8,9,10-tetrahydrophenanthridine (PubChem CID 10502377) has the molecular formula C19H26N3+ and a molecular weight of 296.44 g/mol. Its IUPAC name is 6-(4,4-dimethylpiperazin-4-ium-1-yl)-7,8,9,10-tetrahydrophenanthridine.
| Compound Name | 6-(4,4-dimethylpiperazin-4-ium-1-yl)-7,8,9,10-tetrahydrophenanthridine |
|---|---|
| PubChem CID | 10502377 |
| Molecular Formula | C19H26N3+ |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 6-(4,4-dimethylpiperazin-4-ium-1-yl)-7,8,9,10-tetrahydrophenanthridine |
| SMILES | C[N+]1(C)CCN(c2nc3ccccc3c3c2CCCC3)CC1 |
| InChI | InChI=1S/C19H26N3/c1-22(2)13-11-21(12-14-22)19-17-9-4-3-7-15(17)16-8-5-6-10-18(16)20-19/h5-6,8,10H,3-4,7,9,11-14H2,1-2H3/q+1 |
| InChIKey | YYRWMHFDEFDRNC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|