C27H42O2Si — CID 10502569
(5R)-5-[(Z,1S)-1-methoxy-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde (PubChem CID 10502569) has the molecular formula C27H42O2Si and a molecular weight of 426.72 g/mol. Its IUPAC name is (5R)-5-[(Z,1S)-1-methoxy-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde.
| Compound Name | (5R)-5-[(Z,1S)-1-methoxy-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 10502569 |
| Molecular Formula | C27H42O2Si |
| Molecular Weight | 426.72 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (5R)-5-[(Z,1S)-1-methoxy-7-tri(propan-2-yl)silylhept-4-en-2,6-diynyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde |
| SMILES | CO[C@H](C#C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CCC(C)=C(C=O)C1(C)C |
| InChI | InChI=1S/C27H42O2Si/c1-20(2)30(21(3)4,22(5)6)18-14-12-11-13-15-26(29-10)24-17-16-23(7)25(19-28)27(24,8)9/h11-12,19-22,24,26H,16-17H2,1-10H3/b12-11-/t24-,26+/m0/s1 |
| InChIKey | XPUJXVZGLCDTIB-RSBZSLPRSA-N |
| XLogP | 6.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.72 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|