C11H15F3N2O — CID 105026955
2,2,2-trifluoro-N-methyl-1-(5-propoxy-3-pyridinyl)ethanamine (PubChem CID 105026955) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-1-(5-propoxy-3-pyridinyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N-methyl-1-(5-propoxy-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 105026955 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-1-(5-propoxy-3-pyridinyl)ethanamine |
| SMILES | CCCOc1cncc(C(NC)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O/c1-3-4-17-9-5-8(6-16-7-9)10(15-2)11(12,13)14/h5-7,10,15H,3-4H2,1-2H3 |
| InChIKey | DMTWYAHKXHNSOD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |