C17H18F2IN — CID 105027016
N-[(2,6-difluoro-3-methylphenyl)-(2-iodophenyl)methyl]propan-1-amine (PubChem CID 105027016) has the molecular formula C17H18F2IN and a molecular weight of 401.24 g/mol. Its IUPAC name is N-[(2,6-difluoro-3-methylphenyl)-(2-iodophenyl)methyl]propan-1-amine.
| Compound Name | N-[(2,6-difluoro-3-methylphenyl)-(2-iodophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105027016 |
| Molecular Formula | C17H18F2IN |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[(2,6-difluoro-3-methylphenyl)-(2-iodophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccccc1I)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C17H18F2IN/c1-3-10-21-17(12-6-4-5-7-14(12)20)15-13(18)9-8-11(2)16(15)19/h4-9,17,21H,3,10H2,1-2H3 |
| InChIKey | OLXUOTVAJIDTJR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|