C17H27F2N — CID 105027083
1-(2,6-difluoro-3-methylphenyl)-N,2-diethylhexan-1-amine (PubChem CID 105027083) has the molecular formula C17H27F2N and a molecular weight of 283.41 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)-N,2-diethylhexan-1-amine.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)-N,2-diethylhexan-1-amine |
|---|---|
| PubChem CID | 105027083 |
| Molecular Formula | C17H27F2N |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)-N,2-diethylhexan-1-amine |
| SMILES | CCCCC(CC)C(NCC)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C17H27F2N/c1-5-8-9-13(6-2)17(20-7-3)15-14(18)11-10-12(4)16(15)19/h10-11,13,17,20H,5-9H2,1-4H3 |
| InChIKey | DITZIWWRAACGDM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |