C18H28BrN — CID 105027676
N-[(2-bromo-4-methylphenyl)-cycloheptylmethyl]propan-1-amine (PubChem CID 105027676) has the molecular formula C18H28BrN and a molecular weight of 338.33 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)-cycloheptylmethyl]propan-1-amine.
| Compound Name | N-[(2-bromo-4-methylphenyl)-cycloheptylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 105027676 |
| Molecular Formula | C18H28BrN |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)-cycloheptylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C)cc1Br)C1CCCCCC1 |
| InChI | InChI=1S/C18H28BrN/c1-3-12-20-18(15-8-6-4-5-7-9-15)16-11-10-14(2)13-17(16)19/h10-11,13,15,18,20H,3-9,12H2,1-2H3 |
| InChIKey | DFGRAQGXUXGJFP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |