C17H26F3N — CID 105028045
N,4-diethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-amine (PubChem CID 105028045) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is N,4-diethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-amine.
| Compound Name | N,4-diethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-amine |
|---|---|
| PubChem CID | 105028045 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N,4-diethyl-1-[4-(trifluoromethyl)phenyl]hexan-2-amine |
| SMILES | CCNC(Cc1ccc(C(F)(F)F)cc1)CC(CC)CC |
| InChI | InChI=1S/C17H26F3N/c1-4-13(5-2)11-16(21-6-3)12-14-7-9-15(10-8-14)17(18,19)20/h7-10,13,16,21H,4-6,11-12H2,1-3H3 |
| InChIKey | RUXAJBOPWJOSKJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |