C20H37N — CID 105028422
N,3-diethyl-1-(3-methyl-1-adamantyl)pentan-1-amine (PubChem CID 105028422) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is N,3-diethyl-1-(3-methyl-1-adamantyl)pentan-1-amine.
| Compound Name | N,3-diethyl-1-(3-methyl-1-adamantyl)pentan-1-amine |
|---|---|
| PubChem CID | 105028422 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | N,3-diethyl-1-(3-methyl-1-adamantyl)pentan-1-amine |
| SMILES | CCNC(CC(CC)CC)C12CC3CC(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C20H37N/c1-5-15(6-2)9-18(21-7-3)20-12-16-8-17(13-20)11-19(4,10-16)14-20/h15-18,21H,5-14H2,1-4H3 |
| InChIKey | GXICVNVQOZBZDV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |