C12H20BrNO — CID 105028730
1-(5-bromofuran-2-yl)-N,5-dimethylhexan-1-amine (PubChem CID 105028730) has the molecular formula C12H20BrNO and a molecular weight of 274.20 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-N,5-dimethylhexan-1-amine.
| Compound Name | 1-(5-bromofuran-2-yl)-N,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 105028730 |
| Molecular Formula | C12H20BrNO |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-N,5-dimethylhexan-1-amine |
| SMILES | CNC(CCCC(C)C)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H20BrNO/c1-9(2)5-4-6-10(14-3)11-7-8-12(13)15-11/h7-10,14H,4-6H2,1-3H3 |
| InChIKey | JQKWVEGYPMUZTH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |