C28H48OS — CID 10502890
3-[(3E,7E)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane (PubChem CID 10502890) has the molecular formula C28H48OS and a molecular weight of 432.76 g/mol. Its IUPAC name is 3-[(3E,7E)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 10502890 |
| Molecular Formula | C28H48OS |
| Molecular Weight | 432.76 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 3-[(3E,7E)-11-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-3,7-dimethylundeca-3,7-dienyl]-2,2-dimethyloxirane |
| SMILES | CC(C)=CCC/C(C)=C/CCSCCC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C28H48OS/c1-23(2)13-10-15-25(4)18-12-22-30-21-9-8-14-24(3)16-11-17-26(5)19-20-27-28(6,7)29-27/h13-14,17-18,27H,8-12,15-16,19-22H2,1-7H3/b24-14+,25-18+,26-17+ |
| InChIKey | FUEQTIAWBFDBLT-OOTSEOJJSA-N |
| XLogP | 9.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.76 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|