C15H17F2NO2 — CID 105029493
1-[3-(difluoromethoxy)phenyl]-N-ethyl-2-(furan-2-yl)ethanamine (PubChem CID 105029493) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-N-ethyl-2-(furan-2-yl)ethanamine.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-N-ethyl-2-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 105029493 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-N-ethyl-2-(furan-2-yl)ethanamine |
| SMILES | CCNC(Cc1ccco1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H17F2NO2/c1-2-18-14(10-12-7-4-8-19-12)11-5-3-6-13(9-11)20-15(16)17/h3-9,14-15,18H,2,10H2,1H3 |
| InChIKey | BSXWUDHFWWFNED-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |