C12H15NOS — CID 105029526
1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanamine (PubChem CID 105029526) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanamine.
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 105029526 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)-2-(furan-2-yl)ethanamine |
| SMILES | Cc1cc(C(N)Cc2ccco2)sc1C |
| InChI | InChI=1S/C12H15NOS/c1-8-6-12(15-9(8)2)11(13)7-10-4-3-5-14-10/h3-6,11H,7,13H2,1-2H3 |
| InChIKey | YADPPVVPQNDTSB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |