C15H17BrClNO — CID 105030232
N-[1-(4-bromo-3-chlorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine (PubChem CID 105030232) has the molecular formula C15H17BrClNO and a molecular weight of 342.66 g/mol. Its IUPAC name is N-[1-(4-bromo-3-chlorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-bromo-3-chlorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105030232 |
| Molecular Formula | C15H17BrClNO |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-[1-(4-bromo-3-chlorophenyl)-2-(furan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccoc1)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C15H17BrClNO/c1-2-6-18-15(8-11-5-7-19-10-11)12-3-4-13(16)14(17)9-12/h3-5,7,9-10,15,18H,2,6,8H2,1H3 |
| InChIKey | IGHNQYUMYDVWRE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |