C28H28N2OSi — CID 10503093
(4-methylphenyl)-[5-[[3-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrrol-2-yl]methyl]-1H-pyrrol-2-yl]methanone (PubChem CID 10503093) has the molecular formula C28H28N2OSi and a molecular weight of 436.63 g/mol. Its IUPAC name is (4-methylphenyl)-[5-[[3-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrrol-2-yl]methyl]-1H-pyrrol-2-yl]methanone.
| Compound Name | (4-methylphenyl)-[5-[[3-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrrol-2-yl]methyl]-1H-pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 10503093 |
| Molecular Formula | C28H28N2OSi |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (4-methylphenyl)-[5-[[3-[4-(2-trimethylsilylethynyl)phenyl]-1H-pyrrol-2-yl]methyl]-1H-pyrrol-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(Cc3[nH]ccc3-c3ccc(C#C[Si](C)(C)C)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C28H28N2OSi/c1-20-5-9-23(10-6-20)28(31)26-14-13-24(30-26)19-27-25(15-17-29-27)22-11-7-21(8-12-22)16-18-32(2,3)4/h5-15,17,29-30H,19H2,1-4H3 |
| InChIKey | UGTVLJDDBVTJMS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|