C14H16IN3O2 — CID 105031250
1-(3,5-dimethoxypyrazin-2-yl)-1-(3-iodophenyl)-N-methylmethanamine (PubChem CID 105031250) has the molecular formula C14H16IN3O2 and a molecular weight of 385.21 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-1-(3-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-1-(3-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105031250 |
| Molecular Formula | C14H16IN3O2 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-1-(3-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cccc(I)c1)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C14H16IN3O2/c1-16-12(9-5-4-6-10(15)7-9)13-14(20-3)18-11(19-2)8-17-13/h4-8,12,16H,1-3H3 |
| InChIKey | PTXYYDHZOOZNSZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|