C18H11IN6 — CID 10503150
10-(4-iodophenyl)-12-phenyl-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 10503150) has the molecular formula C18H11IN6 and a molecular weight of 438.23 g/mol. Its IUPAC name is 10-(4-iodophenyl)-12-phenyl-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-(4-iodophenyl)-12-phenyl-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 10503150 |
| Molecular Formula | C18H11IN6 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 10-(4-iodophenyl)-12-phenyl-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Ic1ccc(-n2cc(-c3ccccc3)c3c2ncn2nnnc32)cc1 |
| InChI | InChI=1S/C18H11IN6/c19-13-6-8-14(9-7-13)24-10-15(12-4-2-1-3-5-12)16-17(24)20-11-25-18(16)21-22-23-25/h1-11H |
| InChIKey | RIHRNGFJRJJIEF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|