C18H28BrNO — CID 105031744
1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-N-methylnonan-2-amine (PubChem CID 105031744) has the molecular formula C18H28BrNO and a molecular weight of 354.33 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-N-methylnonan-2-amine.
| Compound Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-N-methylnonan-2-amine |
|---|---|
| PubChem CID | 105031744 |
| Molecular Formula | C18H28BrNO |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-N-methylnonan-2-amine |
| SMILES | CCCCCCCC(Cc1cc(Br)cc2c1OCC2)NC |
| InChI | InChI=1S/C18H28BrNO/c1-3-4-5-6-7-8-17(20-2)13-15-12-16(19)11-14-9-10-21-18(14)15/h11-12,17,20H,3-10,13H2,1-2H3 |
| InChIKey | OPBPYTNZQVXWQK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|