C28H38O4 — CID 10503181
(6aR,6bS,7R,8aS,12aR,14aS,14bS)-2,7-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-5,6,7,8a,9,10,12,12a,14,14a-decahydropicene-3,8-dione (PubChem CID 10503181) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is (6aR,6bS,7R,8aS,12aR,14aS,14bS)-2,7-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-5,6,7,8a,9,10,12,12a,14,14a-decahydropicene-3,8-dione.
| Compound Name | (6aR,6bS,7R,8aS,12aR,14aS,14bS)-2,7-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-5,6,7,8a,9,10,12,12a,14,14a-decahydropicene-3,8-dione |
|---|---|
| PubChem CID | 10503181 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (6aR,6bS,7R,8aS,12aR,14aS,14bS)-2,7-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-5,6,7,8a,9,10,12,12a,14,14a-decahydropicene-3,8-dione |
| SMILES | CC1=C2CC[C@]3(C)[C@H](CC=C4[C@@H]5CC(C)(C)CC[C@@H]5C(=O)[C@H](O)[C@]43C)[C@@]2(C)C=C(O)C1=O |
| InChI | InChI=1S/C28H38O4/c1-15-18-10-12-27(5)21(26(18,4)14-20(29)22(15)30)8-7-19-17-13-25(2,3)11-9-16(17)23(31)24(32)28(19,27)6/h7,14,16-17,21,24,29,32H,8-13H2,1-6H3/t16-,17+,21+,24-,26-,27+,28-/m0/s1 |
| InChIKey | YOZREUUANSRXNA-DLJNMMGCSA-N |
| XLogP | 5.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|