C24H46O3Si2 — CID 10503186
(5S,6S,6aS)-3-butyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 10503186) has the molecular formula C24H46O3Si2 and a molecular weight of 438.80 g/mol. Its IUPAC name is (5S,6S,6aS)-3-butyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (5S,6S,6aS)-3-butyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 10503186 |
| Molecular Formula | C24H46O3Si2 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (5S,6S,6aS)-3-butyl-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CCCCC1=C2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CC1=O |
| InChI | InChI=1S/C24H46O3Si2/c1-12-13-14-17-18-16-21(26-28(8,9)23(2,3)4)22(19(18)15-20(17)25)27-29(10,11)24(5,6)7/h19,21-22H,12-16H2,1-11H3/t19-,21-,22-/m0/s1 |
| InChIKey | WUGNDRDHFZWXOV-BVSLBCMMSA-N |
| XLogP | 7.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|