C12H21N3O — CID 105031969
1-(3-methoxypyrazin-2-yl)-N,3-dimethylpentan-1-amine (PubChem CID 105031969) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(3-methoxypyrazin-2-yl)-N,3-dimethylpentan-1-amine.
| Compound Name | 1-(3-methoxypyrazin-2-yl)-N,3-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 105031969 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-(3-methoxypyrazin-2-yl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)c1nccnc1OC |
| InChI | InChI=1S/C12H21N3O/c1-5-9(2)8-10(13-3)11-12(16-4)15-7-6-14-11/h6-7,9-10,13H,5,8H2,1-4H3 |
| InChIKey | CCYMGPGMAVTEGV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |