C16H19ClFNOS — CID 105032431
N-[2-(2-chloro-3-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethyl]propan-1-amine (PubChem CID 105032431) has the molecular formula C16H19ClFNOS and a molecular weight of 327.85 g/mol. Its IUPAC name is N-[2-(2-chloro-3-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2-chloro-3-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105032431 |
| Molecular Formula | C16H19ClFNOS |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[2-(2-chloro-3-fluorophenyl)-1-(3-methoxythiophen-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1cccc(F)c1Cl)c1sccc1OC |
| InChI | InChI=1S/C16H19ClFNOS/c1-3-8-19-13(16-14(20-2)7-9-21-16)10-11-5-4-6-12(18)15(11)17/h4-7,9,13,19H,3,8,10H2,1-2H3 |
| InChIKey | VPQONBXARPSKDY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |