C27H28N4O2 — CID 10503257
2-(4,4-diphenylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine (PubChem CID 10503257) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-(4,4-diphenylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 2-(4,4-diphenylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 10503257 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-(4,4-diphenylpiperidin-1-yl)-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCC(c4ccccc4)(c4ccccc4)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C27H28N4O2/c1-32-23-17-21-22(18-24(23)33-2)29-26(30-25(21)28)31-15-13-27(14-16-31,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18H,13-16H2,1-2H3,(H2,28,29,30) |
| InChIKey | AZNDJFDHVWENRU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |