C17H33NO — CID 105033094
1-(3,4-dihydro-2H-pyran-5-yl)-N-propylnonan-1-amine (PubChem CID 105033094) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-5-yl)-N-propylnonan-1-amine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-5-yl)-N-propylnonan-1-amine |
|---|---|
| PubChem CID | 105033094 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-5-yl)-N-propylnonan-1-amine |
| SMILES | CCCCCCCCC(NCCC)C1=COCCC1 |
| InChI | InChI=1S/C17H33NO/c1-3-5-6-7-8-9-12-17(18-13-4-2)16-11-10-14-19-15-16/h15,17-18H,3-14H2,1-2H3 |
| InChIKey | QQBFBBJKNONNOL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|