C30H38N2O — CID 10503374
(2S,5R)-1-(2-benzhydryloxyethyl)-2,5-dimethyl-4-(3-phenylpropyl)piperazine (PubChem CID 10503374) has the molecular formula C30H38N2O and a molecular weight of 442.65 g/mol. Its IUPAC name is (2S,5R)-1-(2-benzhydryloxyethyl)-2,5-dimethyl-4-(3-phenylpropyl)piperazine.
| Compound Name | (2S,5R)-1-(2-benzhydryloxyethyl)-2,5-dimethyl-4-(3-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 10503374 |
| Molecular Formula | C30H38N2O |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | (2S,5R)-1-(2-benzhydryloxyethyl)-2,5-dimethyl-4-(3-phenylpropyl)piperazine |
| SMILES | C[C@@H]1CN(CCOC(c2ccccc2)c2ccccc2)[C@@H](C)CN1CCCc1ccccc1 |
| InChI | InChI=1S/C30H38N2O/c1-25-24-32(26(2)23-31(25)20-12-15-27-13-6-3-7-14-27)21-22-33-30(28-16-8-4-9-17-28)29-18-10-5-11-19-29/h3-11,13-14,16-19,25-26,30H,12,15,20-24H2,1-2H3/t25-,26+/m1/s1 |
| InChIKey | XFHMIYUKNNXRRC-FTJBHMTQSA-N |
| XLogP | 5.82 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |