C20H25BrF2N2O2 — CID 10503393
methyl 3-[(4S)-5-bromo-4-methylpentyl]-4-(3,4-difluorophenyl)-2,6-dimethyl-4H-pyrimidine-5-carboxylate (PubChem CID 10503393) has the molecular formula C20H25BrF2N2O2 and a molecular weight of 443.33 g/mol. Its IUPAC name is methyl 3-[(4S)-5-bromo-4-methylpentyl]-4-(3,4-difluorophenyl)-2,6-dimethyl-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl 3-[(4S)-5-bromo-4-methylpentyl]-4-(3,4-difluorophenyl)-2,6-dimethyl-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10503393 |
| Molecular Formula | C20H25BrF2N2O2 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | methyl 3-[(4S)-5-bromo-4-methylpentyl]-4-(3,4-difluorophenyl)-2,6-dimethyl-4H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)N(CCCC(C)CBr)C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H25BrF2N2O2/c1-12(11-21)6-5-9-25-14(3)24-13(2)18(20(26)27-4)19(25)15-7-8-16(22)17(23)10-15/h7-8,10,12,19H,5-6,9,11H2,1-4H3 |
| InChIKey | BIWQCUBHYGNKRE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|