C13H23N — CID 105033966
1-(2,2,3,3-tetramethylcyclopropyl)hex-5-yn-1-amine (PubChem CID 105033966) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 1-(2,2,3,3-tetramethylcyclopropyl)hex-5-yn-1-amine.
| Compound Name | 1-(2,2,3,3-tetramethylcyclopropyl)hex-5-yn-1-amine |
|---|---|
| PubChem CID | 105033966 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 1-(2,2,3,3-tetramethylcyclopropyl)hex-5-yn-1-amine |
| SMILES | C#CCCCC(N)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H23N/c1-6-7-8-9-10(14)11-12(2,3)13(11,4)5/h1,10-11H,7-9,14H2,2-5H3 |
| InChIKey | SUAWHFFCWWNQLX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|