C21H32O10 — CID 10503446
diethyl (2S,3R,7R,8S)-2,3,7,8-tetrahydroxy-5-[(4-methoxyphenyl)methoxy]nonanedioate (PubChem CID 10503446) has the molecular formula C21H32O10 and a molecular weight of 444.48 g/mol. Its IUPAC name is diethyl (2S,3R,7R,8S)-2,3,7,8-tetrahydroxy-5-[(4-methoxyphenyl)methoxy]nonanedioate.
| Compound Name | diethyl (2S,3R,7R,8S)-2,3,7,8-tetrahydroxy-5-[(4-methoxyphenyl)methoxy]nonanedioate |
|---|---|
| PubChem CID | 10503446 |
| Molecular Formula | C21H32O10 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | diethyl (2S,3R,7R,8S)-2,3,7,8-tetrahydroxy-5-[(4-methoxyphenyl)methoxy]nonanedioate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)CC(C[C@@H](O)[C@H](O)C(=O)OCC)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H32O10/c1-4-29-20(26)18(24)16(22)10-15(11-17(23)19(25)21(27)30-5-2)31-12-13-6-8-14(28-3)9-7-13/h6-9,15-19,22-25H,4-5,10-12H2,1-3H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | BVHONWSAFZASGN-YRXWBPOGSA-N |
| XLogP | -0.07 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |