C25H34O7 — CID 10503539
[(1S,3S,5R,6Z,10R,11S,15S)-3-[(2R)-1-methoxy-1-oxopropan-2-yl]-7,11,15-trimethyl-2,14-dioxo-4-oxatricyclo[9.4.0.03,5]pentadeca-6,12-dien-10-yl] butanoate (PubChem CID 10503539) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is [(1S,3S,5R,6Z,10R,11S,15S)-3-[(2R)-1-methoxy-1-oxopropan-2-yl]-7,11,15-trimethyl-2,14-dioxo-4-oxatricyclo[9.4.0.03,5]pentadeca-6,12-dien-10-yl] butanoate.
| Compound Name | [(1S,3S,5R,6Z,10R,11S,15S)-3-[(2R)-1-methoxy-1-oxopropan-2-yl]-7,11,15-trimethyl-2,14-dioxo-4-oxatricyclo[9.4.0.03,5]pentadeca-6,12-dien-10-yl] butanoate |
|---|---|
| PubChem CID | 10503539 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [(1S,3S,5R,6Z,10R,11S,15S)-3-[(2R)-1-methoxy-1-oxopropan-2-yl]-7,11,15-trimethyl-2,14-dioxo-4-oxatricyclo[9.4.0.03,5]pentadeca-6,12-dien-10-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1CC/C(C)=C\[C@H]2O[C@]2([C@@H](C)C(=O)OC)C(=O)[C@H]2[C@H](C)C(=O)C=C[C@]12C |
| InChI | InChI=1S/C25H34O7/c1-7-8-20(27)31-18-10-9-14(2)13-19-25(32-19,16(4)23(29)30-6)22(28)21-15(3)17(26)11-12-24(18,21)5/h11-13,15-16,18-19,21H,7-10H2,1-6H3/b14-13-/t15-,16+,18-,19-,21-,24-,25+/m1/s1 |
| InChIKey | RCDSFTUSHMUUCY-GGBGNHJBSA-N |
| XLogP | 3.35 |
| TPSA | 99.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|