C14H15FINOS — CID 105035474
2-(2-fluoro-3-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine (PubChem CID 105035474) has the molecular formula C14H15FINOS and a molecular weight of 391.25 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105035474 |
| Molecular Formula | C14H15FINOS |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylethanamine |
| SMILES | CNC(Cc1cccc(OC)c1F)c1csc(I)c1 |
| InChI | InChI=1S/C14H15FINOS/c1-17-11(10-7-13(16)19-8-10)6-9-4-3-5-12(18-2)14(9)15/h3-5,7-8,11,17H,6H2,1-2H3 |
| InChIKey | UOIJPRXNMQWMNA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|