C17H20FNO2 — CID 105035532
2-(2-fluoro-3-methoxyphenyl)-1-(3-methoxy-4-methylphenyl)ethanamine (PubChem CID 105035532) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-(2-fluoro-3-methoxyphenyl)-1-(3-methoxy-4-methylphenyl)ethanamine.
| Compound Name | 2-(2-fluoro-3-methoxyphenyl)-1-(3-methoxy-4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 105035532 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-(2-fluoro-3-methoxyphenyl)-1-(3-methoxy-4-methylphenyl)ethanamine |
| SMILES | COc1cc(C(N)Cc2cccc(OC)c2F)ccc1C |
| InChI | InChI=1S/C17H20FNO2/c1-11-7-8-12(10-16(11)21-3)14(19)9-13-5-4-6-15(20-2)17(13)18/h4-8,10,14H,9,19H2,1-3H3 |
| InChIKey | FWZKFUKYIIXOBB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |