C18H25BrN2 — CID 105036523
2-(5-bromo-2-pyridinyl)-1-(3-methyl-1-adamantyl)ethanamine (PubChem CID 105036523) has the molecular formula C18H25BrN2 and a molecular weight of 349.32 g/mol. Its IUPAC name is 2-(5-bromo-2-pyridinyl)-1-(3-methyl-1-adamantyl)ethanamine.
| Compound Name | 2-(5-bromo-2-pyridinyl)-1-(3-methyl-1-adamantyl)ethanamine |
|---|---|
| PubChem CID | 105036523 |
| Molecular Formula | C18H25BrN2 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-(5-bromo-2-pyridinyl)-1-(3-methyl-1-adamantyl)ethanamine |
| SMILES | CC12CC3CC(C1)CC(C(N)Cc1ccc(Br)cn1)(C3)C2 |
| InChI | InChI=1S/C18H25BrN2/c1-17-6-12-4-13(7-17)9-18(8-12,11-17)16(20)5-15-3-2-14(19)10-21-15/h2-3,10,12-13,16H,4-9,11,20H2,1H3 |
| InChIKey | LHKUOEREXDBTCY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |