C15H16BrClN2 — CID 105036789
2-(5-bromo-3-pyridinyl)-1-(5-chloro-2-methylphenyl)-N-methylethanamine (PubChem CID 105036789) has the molecular formula C15H16BrClN2 and a molecular weight of 339.66 g/mol. Its IUPAC name is 2-(5-bromo-3-pyridinyl)-1-(5-chloro-2-methylphenyl)-N-methylethanamine.
| Compound Name | 2-(5-bromo-3-pyridinyl)-1-(5-chloro-2-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 105036789 |
| Molecular Formula | C15H16BrClN2 |
| Molecular Weight | 339.66 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-(5-bromo-3-pyridinyl)-1-(5-chloro-2-methylphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cncc(Br)c1)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C15H16BrClN2/c1-10-3-4-13(17)7-14(10)15(18-2)6-11-5-12(16)9-19-8-11/h3-5,7-9,15,18H,6H2,1-2H3 |
| InChIKey | YFWYLHPQBSIINS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.66 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |