C23H31NO6S — CID 10503690
(1S,3R,4E,6R,8R,10R)-4-(2,2-dimethoxyethylidene)-13,13-dimethyl-6-(4-nitrophenyl)-7-oxa-3λ4-thiatricyclo[8.2.1.01,8]tridecane 3-oxide (PubChem CID 10503690) has the molecular formula C23H31NO6S and a molecular weight of 449.57 g/mol. Its IUPAC name is (1S,3R,4E,6R,8R,10R)-4-(2,2-dimethoxyethylidene)-13,13-dimethyl-6-(4-nitrophenyl)-7-oxa-3λ4-thiatricyclo[8.2.1.01,8]tridecane 3-oxide.
| Compound Name | (1S,3R,4E,6R,8R,10R)-4-(2,2-dimethoxyethylidene)-13,13-dimethyl-6-(4-nitrophenyl)-7-oxa-3λ4-thiatricyclo[8.2.1.01,8]tridecane 3-oxide |
|---|---|
| PubChem CID | 10503690 |
| Molecular Formula | C23H31NO6S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (1S,3R,4E,6R,8R,10R)-4-(2,2-dimethoxyethylidene)-13,13-dimethyl-6-(4-nitrophenyl)-7-oxa-3λ4-thiatricyclo[8.2.1.01,8]tridecane 3-oxide |
| SMILES | COC(/C=C1\C[C@H](c2ccc([N+](=O)[O-])cc2)O[C@@H]2C[C@H]3CC[C@]2(C[S@]1=O)C3(C)C)OC |
| InChI | InChI=1S/C23H31NO6S/c1-22(2)16-9-10-23(22)14-31(27)18(13-21(28-3)29-4)12-19(30-20(23)11-16)15-5-7-17(8-6-15)24(25)26/h5-8,13,16,19-21H,9-12,14H2,1-4H3/b18-13+/t16-,19-,20-,23-,31-/m1/s1 |
| InChIKey | YTRAITUESIHTIJ-ICEAQBDLSA-N |
| XLogP | 4.50 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|