C16H14Cl6O2 — CID 10503747
(1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(1S)-1-(4-methoxyphenoxy)ethyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 10503747) has the molecular formula C16H14Cl6O2 and a molecular weight of 451.00 g/mol. Its IUPAC name is (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(1S)-1-(4-methoxyphenoxy)ethyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(1S)-1-(4-methoxyphenoxy)ethyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 10503747 |
| Molecular Formula | C16H14Cl6O2 |
| Molecular Weight | 451.00 g/mol |
| Exact Mass | 447.91 |
| IUPAC Name | (1R,4S,5R)-1,2,3,4,7,7-hexachloro-5-[(1S)-1-(4-methoxyphenoxy)ethyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | COc1ccc(O[C@@H](C)[C@H]2C[C@@]3(Cl)C(Cl)=C(Cl)[C@]2(Cl)C3(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H14Cl6O2/c1-8(24-10-5-3-9(23-2)4-6-10)11-7-14(19)12(17)13(18)15(11,20)16(14,21)22/h3-6,8,11H,7H2,1-2H3/t8-,11+,14+,15-/m0/s1 |
| InChIKey | UJAWMSCVDNMJEO-ATLFLLQCSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.00 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|