C14H18F2N4O — CID 105038760
1-[3-(difluoromethoxy)phenyl]-N-methyl-1-(3-propyltriazol-4-yl)methanamine (PubChem CID 105038760) has the molecular formula C14H18F2N4O and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-N-methyl-1-(3-propyltriazol-4-yl)methanamine.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-N-methyl-1-(3-propyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 105038760 |
| Molecular Formula | C14H18F2N4O |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-N-methyl-1-(3-propyltriazol-4-yl)methanamine |
| SMILES | CCCn1nncc1C(NC)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H18F2N4O/c1-3-7-20-12(9-18-19-20)13(17-2)10-5-4-6-11(8-10)21-14(15)16/h4-6,8-9,13-14,17H,3,7H2,1-2H3 |
| InChIKey | ZZIUCTTWEMTPBE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |