C13H15F3N4 — CID 105038832
N-methyl-1-(3-propyltriazol-4-yl)-1-(2,3,4-trifluorophenyl)methanamine (PubChem CID 105038832) has the molecular formula C13H15F3N4 and a molecular weight of 284.29 g/mol. Its IUPAC name is N-methyl-1-(3-propyltriazol-4-yl)-1-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | N-methyl-1-(3-propyltriazol-4-yl)-1-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105038832 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-methyl-1-(3-propyltriazol-4-yl)-1-(2,3,4-trifluorophenyl)methanamine |
| SMILES | CCCn1nncc1C(NC)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H15F3N4/c1-3-6-20-10(7-18-19-20)13(17-2)8-4-5-9(14)12(16)11(8)15/h4-5,7,13,17H,3,6H2,1-2H3 |
| InChIKey | RLORCBVWZRXIAR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|