C24H26FN3O5 — CID 10503947
3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)-N-methylcarbamate (PubChem CID 10503947) has the molecular formula C24H26FN3O5 and a molecular weight of 455.49 g/mol. Its IUPAC name is 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)-N-methylcarbamate.
| Compound Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 10503947 |
| Molecular Formula | C24H26FN3O5 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propyl N-(1,3-benzodioxol-5-yl)-N-methylcarbamate |
| SMILES | CN(C(=O)OCCCN1CCC(c2noc3cc(F)ccc23)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H26FN3O5/c1-27(18-4-6-20-22(14-18)32-15-31-20)24(29)30-12-2-9-28-10-7-16(8-11-28)23-19-5-3-17(25)13-21(19)33-26-23/h3-6,13-14,16H,2,7-12,15H2,1H3 |
| InChIKey | NKGXOJDPHNNUBQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|