C25H37N5O3 — CID 10503960
2-[4-[4-(1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)butyl]piperazin-1-yl]-N-propylbenzamide (PubChem CID 10503960) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-[4-[4-(1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)butyl]piperazin-1-yl]-N-propylbenzamide.
| Compound Name | 2-[4-[4-(1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)butyl]piperazin-1-yl]-N-propylbenzamide |
|---|---|
| PubChem CID | 10503960 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 2-[4-[4-(1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-2-yl)butyl]piperazin-1-yl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1N1CCN(CCCCN2C(=O)C3CCCCN3C2=O)CC1 |
| InChI | InChI=1S/C25H37N5O3/c1-2-12-26-23(31)20-9-3-4-10-21(20)28-18-16-27(17-19-28)13-7-8-15-30-24(32)22-11-5-6-14-29(22)25(30)33/h3-4,9-10,22H,2,5-8,11-19H2,1H3,(H,26,31) |
| InChIKey | MAPLINZMAAZKRZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|