C28H28N2O4 — CID 10503994
[3-(2,2-dimethylpropanoyloxy)-2-(1,10-phenanthrolin-2-yl)phenyl] 2,2-dimethylpropanoate (PubChem CID 10503994) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoyloxy)-2-(1,10-phenanthrolin-2-yl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-(2,2-dimethylpropanoyloxy)-2-(1,10-phenanthrolin-2-yl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10503994 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [3-(2,2-dimethylpropanoyloxy)-2-(1,10-phenanthrolin-2-yl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cccc(OC(=O)C(C)(C)C)c1-c1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C28H28N2O4/c1-27(2,3)25(31)33-20-10-7-11-21(34-26(32)28(4,5)6)22(20)19-15-14-18-13-12-17-9-8-16-29-23(17)24(18)30-19/h7-16H,1-6H3 |
| InChIKey | JZHHNJRUISYYNV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|