C11H18BrN3O — CID 105040053
(4-bromo-1-ethylpyrazol-5-yl)-(5-methyloxolan-2-yl)methanamine (PubChem CID 105040053) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrazol-5-yl)-(5-methyloxolan-2-yl)methanamine.
| Compound Name | (4-bromo-1-ethylpyrazol-5-yl)-(5-methyloxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 105040053 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (4-bromo-1-ethylpyrazol-5-yl)-(5-methyloxolan-2-yl)methanamine |
| SMILES | CCn1ncc(Br)c1C(N)C1CCC(C)O1 |
| InChI | InChI=1S/C11H18BrN3O/c1-3-15-11(8(12)6-14-15)10(13)9-5-4-7(2)16-9/h6-7,9-10H,3-5,13H2,1-2H3 |
| InChIKey | LGDOWZOMCMRWLG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |