C17H30ClN3 — CID 105040484
N-[(4-chloro-1-ethylpyrazol-5-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]ethanamine (PubChem CID 105040484) has the molecular formula C17H30ClN3 and a molecular weight of 311.90 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-5-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]ethanamine.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-5-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]ethanamine |
|---|---|
| PubChem CID | 105040484 |
| Molecular Formula | C17H30ClN3 |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-5-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]ethanamine |
| SMILES | CCNC(c1c(Cl)cnn1CC)C1(CC(C)C)CCCC1 |
| InChI | InChI=1S/C17H30ClN3/c1-5-19-16(15-14(18)12-20-21(15)6-2)17(11-13(3)4)9-7-8-10-17/h12-13,16,19H,5-11H2,1-4H3 |
| InChIKey | HSKCATZALPRZNH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |