C14H16ClF2N3O — CID 105041901
(4-chloro-1-propan-2-ylpyrazol-5-yl)-[4-(difluoromethoxy)phenyl]methanamine (PubChem CID 105041901) has the molecular formula C14H16ClF2N3O and a molecular weight of 315.75 g/mol. Its IUPAC name is (4-chloro-1-propan-2-ylpyrazol-5-yl)-[4-(difluoromethoxy)phenyl]methanamine.
| Compound Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-[4-(difluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 105041901 |
| Molecular Formula | C14H16ClF2N3O |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)-[4-(difluoromethoxy)phenyl]methanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H16ClF2N3O/c1-8(2)20-13(11(15)7-19-20)12(18)9-3-5-10(6-4-9)21-14(16)17/h3-8,12,14H,18H2,1-2H3 |
| InChIKey | QWBOBNUIFOJTKK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |