C13H22BrN3 — CID 105042259
1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-2-cyclopentylethanamine (PubChem CID 105042259) has the molecular formula C13H22BrN3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-2-cyclopentylethanamine.
| Compound Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-2-cyclopentylethanamine |
|---|---|
| PubChem CID | 105042259 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-2-cyclopentylethanamine |
| SMILES | CC(C)n1ncc(Br)c1C(N)CC1CCCC1 |
| InChI | InChI=1S/C13H22BrN3/c1-9(2)17-13(11(14)8-16-17)12(15)7-10-5-3-4-6-10/h8-10,12H,3-7,15H2,1-2H3 |
| InChIKey | UIESLAKWROYAAG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |