C22H23N2O3+ — CID 10504274
methyl 2-(2,4-diethyl-6-oxo-5-phenyl-1H-pyrimidin-3-ium-3-yl)benzoate (PubChem CID 10504274) has the molecular formula C22H23N2O3+ and a molecular weight of 363.44 g/mol. Its IUPAC name is methyl 2-(2,4-diethyl-6-oxo-5-phenyl-1H-pyrimidin-3-ium-3-yl)benzoate.
| Compound Name | methyl 2-(2,4-diethyl-6-oxo-5-phenyl-1H-pyrimidin-3-ium-3-yl)benzoate |
|---|---|
| PubChem CID | 10504274 |
| Molecular Formula | C22H23N2O3+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | methyl 2-(2,4-diethyl-6-oxo-5-phenyl-1H-pyrimidin-3-ium-3-yl)benzoate |
| SMILES | CCc1[nH]c(=O)c(-c2ccccc2)c(CC)[n+]1-c1ccccc1C(=O)OC |
| InChI | InChI=1S/C22H22N2O3/c1-4-17-20(15-11-7-6-8-12-15)21(25)23-19(5-2)24(17)18-14-10-9-13-16(18)22(26)27-3/h6-14H,4-5H2,1-3H3/p+1 |
| InChIKey | JDDYHNGGZRKMMJ-UHFFFAOYSA-O |
| XLogP | 3.23 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|