C26H28N2O4S — CID 10504337
(2E)-2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid (PubChem CID 10504337) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is (2E)-2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid.
| Compound Name | (2E)-2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid |
|---|---|
| PubChem CID | 10504337 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (2E)-2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]iminopropanoic acid |
| SMILES | C/C(=N\OC(c1ccc(OCc2nc(-c3ccccc3)cs2)cc1)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C26H28N2O4S/c1-18(26(29)30)28-32-25(20-10-6-3-7-11-20)21-12-14-22(15-13-21)31-16-24-27-23(17-33-24)19-8-4-2-5-9-19/h2,4-5,8-9,12-15,17,20,25H,3,6-7,10-11,16H2,1H3,(H,29,30)/b28-18+ |
| InChIKey | VFUYXLYPZOUDSL-MTDXEUNCSA-N |
| XLogP | 6.49 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|