C11H22N4O2S — CID 105043401
2-methyl-2-methylsulfonyl-1-(3-methyltriazol-4-yl)-N-propylpropan-1-amine (PubChem CID 105043401) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-methyl-2-methylsulfonyl-1-(3-methyltriazol-4-yl)-N-propylpropan-1-amine.
| Compound Name | 2-methyl-2-methylsulfonyl-1-(3-methyltriazol-4-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 105043401 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-methyl-2-methylsulfonyl-1-(3-methyltriazol-4-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cnnn1C)C(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N4O2S/c1-6-7-12-10(9-8-13-14-15(9)4)11(2,3)18(5,16)17/h8,10,12H,6-7H2,1-5H3 |
| InChIKey | CKBCRCILGSOJGL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |