C27H48O4Si — CID 10504344
(1S,3R,7S,9S,10R,12S,13S,14R)-9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadec-4-en-2-one (PubChem CID 10504344) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is (1S,3R,7S,9S,10R,12S,13S,14R)-9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadec-4-en-2-one.
| Compound Name | (1S,3R,7S,9S,10R,12S,13S,14R)-9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadec-4-en-2-one |
|---|---|
| PubChem CID | 10504344 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | (1S,3R,7S,9S,10R,12S,13S,14R)-9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-13-methoxy-3,6,6,10,14-pentamethyltricyclo[10.3.0.03,7]pentadec-4-en-2-one |
| SMILES | CO[C@@H]1[C@H]2C[C@@](C)(O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3C(C)(C)C=C[C@@]3(C)C(=O)[C@H]2C[C@H]1C |
| InChI | InChI=1S/C27H48O4Si/c1-17-14-18-19(22(17)30-9)16-27(8,29)21(31-32(10,11)24(2,3)4)15-20-25(5,6)12-13-26(20,7)23(18)28/h12-13,17-22,29H,14-16H2,1-11H3/t17-,18+,19+,20+,21+,22+,26-,27-/m1/s1 |
| InChIKey | AFLATMASZAHJQH-YJCZRAKLSA-N |
| XLogP | 6.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|